C7H12Cl3NO6 — CID 59898246
2-(hydroxymethyl)-6-(trichloromethylamino)oxyoxane-3,4,5-triol (PubChem CID 59898246) has the molecular formula C7H12Cl3NO6 and a molecular weight of 312.53 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-(trichloromethylamino)oxyoxane-3,4,5-triol.
| Compound Name | 2-(hydroxymethyl)-6-(trichloromethylamino)oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 59898246 |
| Molecular Formula | C7H12Cl3NO6 |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 310.97 |
| IUPAC Name | 2-(hydroxymethyl)-6-(trichloromethylamino)oxyoxane-3,4,5-triol |
| SMILES | OCC1OC(ONC(Cl)(Cl)Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C7H12Cl3NO6/c8-7(9,10)11-17-6-5(15)4(14)3(13)2(1-12)16-6/h2-6,11-15H,1H2 |
| InChIKey | HQEKYJAYLNSXSE-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|