C10H21NO6 — CID 130198593
(4S,5R)-2-(butan-2-ylamino)oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 130198593) has the molecular formula C10H21NO6 and a molecular weight of 251.28 g/mol. Its IUPAC name is (4S,5R)-2-(butan-2-ylamino)oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (4S,5R)-2-(butan-2-ylamino)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 130198593 |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | (4S,5R)-2-(butan-2-ylamino)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCC(C)NOC1OC(CO)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C10H21NO6/c1-3-5(2)11-17-10-9(15)8(14)7(13)6(4-12)16-10/h5-15H,3-4H2,1-2H3/t5?,6?,7-,8-,9?,10?/m0/s1 |
| InChIKey | ICSSYYKYRLNCLN-QLHQWBLOSA-N |
| XLogP | -1.89 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|