C11H23NO6 — CID 18605016
(3R,4S,5S,6R)-2-[1-(dimethylamino)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 18605016) has the molecular formula C11H23NO6 and a molecular weight of 265.31 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-[1-(dimethylamino)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-[1-(dimethylamino)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 18605016 |
| Molecular Formula | C11H23NO6 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (3R,4S,5S,6R)-2-[1-(dimethylamino)propoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCC(OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)N(C)C |
| InChI | InChI=1S/C11H23NO6/c1-4-7(12(2)3)18-11-10(16)9(15)8(14)6(5-13)17-11/h6-11,13-16H,4-5H2,1-3H3/t6-,7?,8-,9+,10-,11?/m1/s1 |
| InChIKey | LDZQYBNSGLAGTD-OJHRSCCRSA-N |
| XLogP | -1.90 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|