C12H16O2S — CID 11790849
[(3S,4S)-4-phenylmethoxythiolan-3-yl]methanol (PubChem CID 11790849) has the molecular formula C12H16O2S and a molecular weight of 224.32 g/mol. Its IUPAC name is [(3S,4S)-4-phenylmethoxythiolan-3-yl]methanol.
| Compound Name | [(3S,4S)-4-phenylmethoxythiolan-3-yl]methanol |
|---|---|
| PubChem CID | 11790849 |
| Molecular Formula | C12H16O2S |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | [(3S,4S)-4-phenylmethoxythiolan-3-yl]methanol |
| SMILES | OC[C@@H]1CSC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C12H16O2S/c13-6-11-8-15-9-12(11)14-7-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2/t11-,12-/m1/s1 |
| InChIKey | VRXYDXDOTFFNPT-VXGBXAGGSA-N |
| XLogP | 1.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |