C47H47O8P — CID 11228060
diphenyl [(1R,2R,3S,4S,5R)-2,3,4,5-tetrakis(phenylmethoxy)cyclohexyl]methyl phosphate (PubChem CID 11228060) has the molecular formula C47H47O8P and a molecular weight of 770.86 g/mol. Its IUPAC name is diphenyl [(1R,2R,3S,4S,5R)-2,3,4,5-tetrakis(phenylmethoxy)cyclohexyl]methyl phosphate.
| Compound Name | diphenyl [(1R,2R,3S,4S,5R)-2,3,4,5-tetrakis(phenylmethoxy)cyclohexyl]methyl phosphate |
|---|---|
| PubChem CID | 11228060 |
| Molecular Formula | C47H47O8P |
| Molecular Weight | 770.86 g/mol |
| Exact Mass | 770.30 |
| IUPAC Name | diphenyl [(1R,2R,3S,4S,5R)-2,3,4,5-tetrakis(phenylmethoxy)cyclohexyl]methyl phosphate |
| SMILES | O=P(OCC1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C47H47O8P/c48-56(54-42-27-15-5-16-28-42,55-43-29-17-6-18-30-43)53-36-41-31-44(49-32-37-19-7-1-8-20-37)46(51-34-39-23-11-3-12-24-39)47(52-35-40-25-13-4-14-26-40)45(41)50-33-38-21-9-2-10-22-38/h1-30,41,44-47H,31-36H2/t41?,44-,45-,46+,47+/m1/s1 |
| InChIKey | FUAFNLWFFKQOFO-LCOVSUJRSA-N |
| XLogP | 10.63 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.86 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|