C29H35NO5S — CID 146430318
[(2R,5S)-5-[methyl(sulfino)amino]-2,3-bis(phenylmethoxy)cyclohexyl]methoxymethylbenzene (PubChem CID 146430318) has the molecular formula C29H35NO5S and a molecular weight of 509.67 g/mol. Its IUPAC name is [(2R,5S)-5-[methyl(sulfino)amino]-2,3-bis(phenylmethoxy)cyclohexyl]methoxymethylbenzene.
| Compound Name | [(2R,5S)-5-[methyl(sulfino)amino]-2,3-bis(phenylmethoxy)cyclohexyl]methoxymethylbenzene |
|---|---|
| PubChem CID | 146430318 |
| Molecular Formula | C29H35NO5S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.22 |
| IUPAC Name | [(2R,5S)-5-[methyl(sulfino)amino]-2,3-bis(phenylmethoxy)cyclohexyl]methoxymethylbenzene |
| SMILES | CN([C@H]1CC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1)S(=O)O |
| InChI | InChI=1S/C29H35NO5S/c1-30(36(31)32)27-17-26(22-33-19-23-11-5-2-6-12-23)29(35-21-25-15-9-4-10-16-25)28(18-27)34-20-24-13-7-3-8-14-24/h2-16,26-29H,17-22H2,1H3,(H,31,32)/t26?,27-,28?,29+/m0/s1 |
| InChIKey | WIUWZEFXPDCFNB-VJCJCUICSA-N |
| XLogP | 5.22 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|