C17H22N2O — CID 102175171
(3R,4S)-2,2-dimethyl-4-phenylmethoxy-1-prop-2-enylpyrrolidine-3-carbonitrile (PubChem CID 102175171) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (3R,4S)-2,2-dimethyl-4-phenylmethoxy-1-prop-2-enylpyrrolidine-3-carbonitrile.
| Compound Name | (3R,4S)-2,2-dimethyl-4-phenylmethoxy-1-prop-2-enylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 102175171 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (3R,4S)-2,2-dimethyl-4-phenylmethoxy-1-prop-2-enylpyrrolidine-3-carbonitrile |
| SMILES | C=CCN1C[C@@H](OCc2ccccc2)[C@@H](C#N)C1(C)C |
| InChI | InChI=1S/C17H22N2O/c1-4-10-19-12-16(15(11-18)17(19,2)3)20-13-14-8-6-5-7-9-14/h4-9,15-16H,1,10,12-13H2,2-3H3/t15-,16-/m1/s1 |
| InChIKey | YVKVSRWISXDWIN-HZPDHXFCSA-N |
| XLogP | 2.99 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|