C20H25NO2 — CID 71528027
(1S,5S,6R)-1-ethenyl-6-phenylmethoxy-2-prop-2-enyl-2-azabicyclo[3.3.1]nonan-4-one (PubChem CID 71528027) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is (1S,5S,6R)-1-ethenyl-6-phenylmethoxy-2-prop-2-enyl-2-azabicyclo[3.3.1]nonan-4-one.
| Compound Name | (1S,5S,6R)-1-ethenyl-6-phenylmethoxy-2-prop-2-enyl-2-azabicyclo[3.3.1]nonan-4-one |
|---|---|
| PubChem CID | 71528027 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (1S,5S,6R)-1-ethenyl-6-phenylmethoxy-2-prop-2-enyl-2-azabicyclo[3.3.1]nonan-4-one |
| SMILES | C=CCN1CC(=O)[C@H]2C[C@]1(C=C)CC[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C20H25NO2/c1-3-12-21-14-18(22)17-13-20(21,4-2)11-10-19(17)23-15-16-8-6-5-7-9-16/h3-9,17,19H,1-2,10-15H2/t17-,19-,20+/m1/s1 |
| InChIKey | MQRLAGAVPMHXSB-RLLQIKCJSA-N |
| XLogP | 3.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|