C23H25NO6 — CID 123542757
dibenzyl 3-hydroxy-4-prop-2-enoxypyrrolidine-1,2-dicarboxylate (PubChem CID 123542757) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is dibenzyl 3-hydroxy-4-prop-2-enoxypyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl 3-hydroxy-4-prop-2-enoxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 123542757 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | dibenzyl 3-hydroxy-4-prop-2-enoxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCOC1CN(C(=O)OCc2ccccc2)C(C(=O)OCc2ccccc2)C1O |
| InChI | InChI=1S/C23H25NO6/c1-2-13-28-19-14-24(23(27)30-16-18-11-7-4-8-12-18)20(21(19)25)22(26)29-15-17-9-5-3-6-10-17/h2-12,19-21,25H,1,13-16H2 |
| InChIKey | HWLCZNMGGQFMQQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|