C19H21N — CID 134951940
2-(4-methylphenyl)-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline (PubChem CID 134951940) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-(4-methylphenyl)-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(4-methylphenyl)-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 134951940 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-(4-methylphenyl)-1-prop-2-enyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C=CCC1c2ccccc2CCN1c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21N/c1-3-6-19-18-8-5-4-7-16(18)13-14-20(19)17-11-9-15(2)10-12-17/h3-5,7-12,19H,1,6,13-14H2,2H3 |
| InChIKey | BLHCTWFNQJFNMX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|