C21H25NOS — CID 135000085
S-tert-butyl 2-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)ethanethioate (PubChem CID 135000085) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is S-tert-butyl 2-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)ethanethioate.
| Compound Name | S-tert-butyl 2-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)ethanethioate |
|---|---|
| PubChem CID | 135000085 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | S-tert-butyl 2-(2-phenyl-3,4-dihydro-1H-isoquinolin-1-yl)ethanethioate |
| SMILES | CC(C)(C)SC(=O)CC1c2ccccc2CCN1c1ccccc1 |
| InChI | InChI=1S/C21H25NOS/c1-21(2,3)24-20(23)15-19-18-12-8-7-9-16(18)13-14-22(19)17-10-5-4-6-11-17/h4-12,19H,13-15H2,1-3H3 |
| InChIKey | UUMXBBPHGXOQHD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|