C14H15N — CID 56588985
1-ethynyl-2-prop-2-enyl-3,4-dihydro-1H-isoquinoline (PubChem CID 56588985) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-ethynyl-2-prop-2-enyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 1-ethynyl-2-prop-2-enyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 56588985 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-ethynyl-2-prop-2-enyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C#CC1c2ccccc2CCN1CC=C |
| InChI | InChI=1S/C14H15N/c1-3-10-15-11-9-12-7-5-6-8-13(12)14(15)4-2/h2-3,5-8,14H,1,9-11H2 |
| InChIKey | XUPOCKIJSNSWTE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|