C18H23N — CID 139188466
(3aR,9bR)-1-propan-2-ylidene-3-prop-2-enyl-3a,4,5,9b-tetrahydro-2H-benzo[e]indole (PubChem CID 139188466) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is (3aR,9bR)-1-propan-2-ylidene-3-prop-2-enyl-3a,4,5,9b-tetrahydro-2H-benzo[e]indole.
| Compound Name | (3aR,9bR)-1-propan-2-ylidene-3-prop-2-enyl-3a,4,5,9b-tetrahydro-2H-benzo[e]indole |
|---|---|
| PubChem CID | 139188466 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (3aR,9bR)-1-propan-2-ylidene-3-prop-2-enyl-3a,4,5,9b-tetrahydro-2H-benzo[e]indole |
| SMILES | C=CCN1CC(=C(C)C)[C@H]2c3ccccc3CC[C@H]21 |
| InChI | InChI=1S/C18H23N/c1-4-11-19-12-16(13(2)3)18-15-8-6-5-7-14(15)9-10-17(18)19/h4-8,17-18H,1,9-12H2,2-3H3/t17-,18-/m1/s1 |
| InChIKey | RIEMRDHQGWPCDC-QZTJIDSGSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|