C17H23NO — CID 67930034
2-methyl-4-prop-2-enyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-7-ol (PubChem CID 67930034) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-methyl-4-prop-2-enyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-7-ol.
| Compound Name | 2-methyl-4-prop-2-enyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-7-ol |
|---|---|
| PubChem CID | 67930034 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2-methyl-4-prop-2-enyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinolin-7-ol |
| SMILES | C=CCN1CC(C)CC2c3cccc(O)c3CCC21 |
| InChI | InChI=1S/C17H23NO/c1-3-9-18-11-12(2)10-15-13-5-4-6-17(19)14(13)7-8-16(15)18/h3-6,12,15-16,19H,1,7-11H2,2H3 |
| InChIKey | JNYMAIQZWYABRU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|