C14H19NO — CID 79368569
3-(6-methoxy-2,3-dihydro-1H-inden-1-yl)pyrrolidine (PubChem CID 79368569) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 3-(6-methoxy-2,3-dihydro-1H-inden-1-yl)pyrrolidine.
| Compound Name | 3-(6-methoxy-2,3-dihydro-1H-inden-1-yl)pyrrolidine |
|---|---|
| PubChem CID | 79368569 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 3-(6-methoxy-2,3-dihydro-1H-inden-1-yl)pyrrolidine |
| SMILES | COc1ccc2c(c1)C(C1CCNC1)CC2 |
| InChI | InChI=1S/C14H19NO/c1-16-12-4-2-10-3-5-13(14(10)8-12)11-6-7-15-9-11/h2,4,8,11,13,15H,3,5-7,9H2,1H3 |
| InChIKey | XMNAVSLJERFAFC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |