C17H24N2O — CID 102677859
1-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine (PubChem CID 102677859) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine.
| Compound Name | 1-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 102677859 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridine |
| SMILES | COc1ccc2c(c1)C(N1CCCC3CNCC31)CC2 |
| InChI | InChI=1S/C17H24N2O/c1-20-14-6-4-12-5-7-16(15(12)9-14)19-8-2-3-13-10-18-11-17(13)19/h4,6,9,13,16-18H,2-3,5,7-8,10-11H2,1H3 |
| InChIKey | FFRMJTXGAMIWDL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |