C16H24N2O — CID 79374347
1-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-2,5-dimethylpiperazine (PubChem CID 79374347) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-2,5-dimethylpiperazine.
| Compound Name | 1-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 79374347 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-(6-methoxy-2,3-dihydro-1H-inden-1-yl)-2,5-dimethylpiperazine |
| SMILES | COc1ccc2c(c1)C(N1CC(C)NCC1C)CC2 |
| InChI | InChI=1S/C16H24N2O/c1-11-10-18(12(2)9-17-11)16-7-5-13-4-6-14(19-3)8-15(13)16/h4,6,8,11-12,16-17H,5,7,9-10H2,1-3H3 |
| InChIKey | SICLHVALPMTQNK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |