C12H18N2O — CID 83860328
2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)propan-1-amine (PubChem CID 83860328) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)propan-1-amine.
| Compound Name | 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 83860328 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(5-methoxy-2,3-dihydro-1H-indol-3-yl)propan-1-amine |
| SMILES | COc1ccc2c(c1)C(C(C)CN)CN2 |
| InChI | InChI=1S/C12H18N2O/c1-8(6-13)11-7-14-12-4-3-9(15-2)5-10(11)12/h3-5,8,11,14H,6-7,13H2,1-2H3 |
| InChIKey | FBQORRJZHRMEID-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|