C12H18N2O — CID 82276688
2-(5-ethoxy-2,3-dihydro-1H-indol-3-yl)ethanamine (PubChem CID 82276688) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 2-(5-ethoxy-2,3-dihydro-1H-indol-3-yl)ethanamine.
| Compound Name | 2-(5-ethoxy-2,3-dihydro-1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 82276688 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 2-(5-ethoxy-2,3-dihydro-1H-indol-3-yl)ethanamine |
| SMILES | CCOc1ccc2c(c1)C(CCN)CN2 |
| InChI | InChI=1S/C12H18N2O/c1-2-15-10-3-4-12-11(7-10)9(5-6-13)8-14-12/h3-4,7,9,14H,2,5-6,8,13H2,1H3 |
| InChIKey | OEGSSFPORKBTKV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|