C12H18N2O — CID 83860271
1-(5-ethoxy-2,3-dihydro-1H-indol-3-yl)-N-methylmethanamine (PubChem CID 83860271) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-(5-ethoxy-2,3-dihydro-1H-indol-3-yl)-N-methylmethanamine.
| Compound Name | 1-(5-ethoxy-2,3-dihydro-1H-indol-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 83860271 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-(5-ethoxy-2,3-dihydro-1H-indol-3-yl)-N-methylmethanamine |
| SMILES | CCOc1ccc2c(c1)C(CNC)CN2 |
| InChI | InChI=1S/C12H18N2O/c1-3-15-10-4-5-12-11(6-10)9(7-13-2)8-14-12/h4-6,9,13-14H,3,7-8H2,1-2H3 |
| InChIKey | GKUUYSNZHWTATA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|