C11H14ClN3O — CID 82237705
3-[2-aminoethyl(methyl)amino]-6-chloro-1,3-dihydroindol-2-one (PubChem CID 82237705) has the molecular formula C11H14ClN3O and a molecular weight of 239.71 g/mol. Its IUPAC name is 3-[2-aminoethyl(methyl)amino]-6-chloro-1,3-dihydroindol-2-one.
| Compound Name | 3-[2-aminoethyl(methyl)amino]-6-chloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82237705 |
| Molecular Formula | C11H14ClN3O |
| Molecular Weight | 239.71 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 3-[2-aminoethyl(methyl)amino]-6-chloro-1,3-dihydroindol-2-one |
| SMILES | CN(CCN)C1C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H14ClN3O/c1-15(5-4-13)10-8-3-2-7(12)6-9(8)14-11(10)16/h2-3,6,10H,4-5,13H2,1H3,(H,14,16) |
| InChIKey | QAZISIRDJCAGBX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.71 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |