C16H14ClNO2 — CID 51971626
(3S)-6-chloro-3-[(3-methoxyphenyl)methyl]-1,3-dihydroindol-2-one (PubChem CID 51971626) has the molecular formula C16H14ClNO2 and a molecular weight of 287.75 g/mol. Its IUPAC name is (3S)-6-chloro-3-[(3-methoxyphenyl)methyl]-1,3-dihydroindol-2-one.
| Compound Name | (3S)-6-chloro-3-[(3-methoxyphenyl)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 51971626 |
| Molecular Formula | C16H14ClNO2 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | (3S)-6-chloro-3-[(3-methoxyphenyl)methyl]-1,3-dihydroindol-2-one |
| SMILES | COc1cccc(C[C@@H]2C(=O)Nc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C16H14ClNO2/c1-20-12-4-2-3-10(7-12)8-14-13-6-5-11(17)9-15(13)18-16(14)19/h2-7,9,14H,8H2,1H3,(H,18,19)/t14-/m0/s1 |
| InChIKey | XVYDBBUGYNTGMA-AWEZNQCLSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |