C23H23N3O3 — CID 59170948
(E)-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide (PubChem CID 59170948) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is (E)-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59170948 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (E)-N-[(4R)-3,4-dihydro-2H-chromen-4-yl]-3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)N[C@@H]2CCOc3ccccc32)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C23H23N3O3/c1-16-14-26(15-24-16)20-9-7-17(13-22(20)28-2)8-10-23(27)25-19-11-12-29-21-6-4-3-5-18(19)21/h3-10,13-15,19H,11-12H2,1-2H3,(H,25,27)/b10-8+/t19-/m1/s1 |
| InChIKey | BMVHJNZTTHXSNU-LHUXKHBRSA-N |
| XLogP | 3.84 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|