C23H22FN3O2 — CID 59170993
(E)-N-(2,3-dihydro-1H-inden-1-yl)-3-[4-[4-(fluoromethyl)imidazol-1-yl]-3-methoxyphenyl]prop-2-enamide (PubChem CID 59170993) has the molecular formula C23H22FN3O2 and a molecular weight of 391.45 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1H-inden-1-yl)-3-[4-[4-(fluoromethyl)imidazol-1-yl]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-(2,3-dihydro-1H-inden-1-yl)-3-[4-[4-(fluoromethyl)imidazol-1-yl]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 59170993 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (E)-N-(2,3-dihydro-1H-inden-1-yl)-3-[4-[4-(fluoromethyl)imidazol-1-yl]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC2CCc3ccccc32)ccc1-n1cnc(CF)c1 |
| InChI | InChI=1S/C23H22FN3O2/c1-29-22-12-16(6-10-21(22)27-14-18(13-24)25-15-27)7-11-23(28)26-20-9-8-17-4-2-3-5-19(17)20/h2-7,10-12,14-15,20H,8-9,13H2,1H3,(H,26,28)/b11-7+ |
| InChIKey | XTIOUXUAXPRPCS-YRNVUSSQSA-N |
| XLogP | 4.17 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|