C22H18N4O — CID 66960991
3-(3-cyano-4-imidazol-1-ylphenyl)-N-(2,3-dihydro-1H-inden-1-yl)prop-2-enamide (PubChem CID 66960991) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is 3-(3-cyano-4-imidazol-1-ylphenyl)-N-(2,3-dihydro-1H-inden-1-yl)prop-2-enamide.
| Compound Name | 3-(3-cyano-4-imidazol-1-ylphenyl)-N-(2,3-dihydro-1H-inden-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 66960991 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 3-(3-cyano-4-imidazol-1-ylphenyl)-N-(2,3-dihydro-1H-inden-1-yl)prop-2-enamide |
| SMILES | N#Cc1cc(C=CC(=O)NC2CCc3ccccc32)ccc1-n1ccnc1 |
| InChI | InChI=1S/C22H18N4O/c23-14-18-13-16(5-9-21(18)26-12-11-24-15-26)6-10-22(27)25-20-8-7-17-3-1-2-4-19(17)20/h1-6,9-13,15,20H,7-8H2,(H,25,27) |
| InChIKey | UZPWGDNKQNXHFH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|