C20H19N3O — CID 175884330
N-(2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide (PubChem CID 175884330) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 175884330 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide |
| SMILES | Cc1[nH]nc2cc(C=CC(=O)NC3CCc4ccccc43)ccc12 |
| InChI | InChI=1S/C20H19N3O/c1-13-16-9-6-14(12-19(16)23-22-13)7-11-20(24)21-18-10-8-15-4-2-3-5-17(15)18/h2-7,9,11-12,18H,8,10H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | GJNIHTWMMMGFBF-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|