C19H20N2O3S — CID 51334157
(E)-N-(2,3-dihydro-1H-inden-1-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide (PubChem CID 51334157) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1H-inden-1-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2,3-dihydro-1H-inden-1-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 51334157 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | (E)-N-(2,3-dihydro-1H-inden-1-yl)-3-[4-(methanesulfonamido)phenyl]prop-2-enamide |
| SMILES | CS(=O)(=O)Nc1ccc(/C=C/C(=O)NC2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-25(23,24)21-16-10-6-14(7-11-16)8-13-19(22)20-18-12-9-15-4-2-3-5-17(15)18/h2-8,10-11,13,18,21H,9,12H2,1H3,(H,20,22)/b13-8+ |
| InChIKey | PGCQIIFWTRTWJW-MDWZMJQESA-N |
| XLogP | 2.88 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|