C26H25N3O2 — CID 59170730
(E)-3-[3-but-2-ynoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2,3-dihydro-1H-inden-1-yl)prop-2-enamide (PubChem CID 59170730) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is (E)-3-[3-but-2-ynoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2,3-dihydro-1H-inden-1-yl)prop-2-enamide.
| Compound Name | (E)-3-[3-but-2-ynoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2,3-dihydro-1H-inden-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 59170730 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (E)-3-[3-but-2-ynoxy-4-(4-methylimidazol-1-yl)phenyl]-N-(2,3-dihydro-1H-inden-1-yl)prop-2-enamide |
| SMILES | CC#CCOc1cc(/C=C/C(=O)NC2CCc3ccccc32)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C26H25N3O2/c1-3-4-15-31-25-16-20(9-13-24(25)29-17-19(2)27-18-29)10-14-26(30)28-23-12-11-21-7-5-6-8-22(21)23/h5-10,13-14,16-18,23H,11-12,15H2,1-2H3,(H,28,30)/b14-10+ |
| InChIKey | RWFLQUTYWDDTNJ-GXDHUFHOSA-N |
| XLogP | 4.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|