C22H23N3OS — CID 143760297
(1S)-N-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]sulfanyl-2,3-dihydro-1H-inden-1-amine (PubChem CID 143760297) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is (1S)-N-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]sulfanyl-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S)-N-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]sulfanyl-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 143760297 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (1S)-N-[(E)-2-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]ethenyl]sulfanyl-2,3-dihydro-1H-inden-1-amine |
| SMILES | COc1cc(/C=C/SN[C@H]2CCc3ccccc32)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C22H23N3OS/c1-16-14-25(15-23-16)21-10-7-17(13-22(21)26-2)11-12-27-24-20-9-8-18-5-3-4-6-19(18)20/h3-7,10-15,20,24H,8-9H2,1-2H3/b12-11+/t20-/m0/s1 |
| InChIKey | FLLCMTMFMUJKNR-SGWGQVFISA-N |
| XLogP | 5.09 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|