C21H21N3O2 — CID 162746986
(E)-N-[(3R,4R)-3-methyl-3,4-dihydro-2H-chromen-4-yl]-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide (PubChem CID 162746986) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (E)-N-[(3R,4R)-3-methyl-3,4-dihydro-2H-chromen-4-yl]-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide.
| Compound Name | (E)-N-[(3R,4R)-3-methyl-3,4-dihydro-2H-chromen-4-yl]-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 162746986 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (E)-N-[(3R,4R)-3-methyl-3,4-dihydro-2H-chromen-4-yl]-3-(3-methyl-2H-indazol-6-yl)prop-2-enamide |
| SMILES | Cc1[nH]nc2cc(/C=C/C(=O)N[C@H]3c4ccccc4OC[C@@H]3C)ccc12 |
| InChI | InChI=1S/C21H21N3O2/c1-13-12-26-19-6-4-3-5-17(19)21(13)22-20(25)10-8-15-7-9-16-14(2)23-24-18(16)11-15/h3-11,13,21H,12H2,1-2H3,(H,22,25)(H,23,24)/b10-8+/t13-,21+/m0/s1 |
| InChIKey | BEDSKROVRVMVLW-SIAPCFSISA-N |
| XLogP | 3.77 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|