C26H30N4O — CID 143143723
(2E,4E)-6-cyano-N-(2,3-dihydro-1H-inden-1-yl)-8-imidazol-1-yl-4-methyldeca-2,4,6,9-tetraenamide;ethane (PubChem CID 143143723) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is (2E,4E)-6-cyano-N-(2,3-dihydro-1H-inden-1-yl)-8-imidazol-1-yl-4-methyldeca-2,4,6,9-tetraenamide;ethane.
| Compound Name | (2E,4E)-6-cyano-N-(2,3-dihydro-1H-inden-1-yl)-8-imidazol-1-yl-4-methyldeca-2,4,6,9-tetraenamide;ethane |
|---|---|
| PubChem CID | 143143723 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | (2E,4E)-6-cyano-N-(2,3-dihydro-1H-inden-1-yl)-8-imidazol-1-yl-4-methyldeca-2,4,6,9-tetraenamide;ethane |
| SMILES | C=CC(C=C(C#N)/C=C(C)/C=C/C(=O)NC1CCc2ccccc21)n1ccnc1.CC |
| InChI | InChI=1S/C24H24N4O.C2H6/c1-3-21(28-13-12-26-17-28)15-19(16-25)14-18(2)8-11-24(29)27-23-10-9-20-6-4-5-7-22(20)23;1-2/h3-8,11-15,17,21,23H,1,9-10H2,2H3,(H,27,29);1-2H3/b11-8+,18-14+,19-15?; |
| InChIKey | PQSPYACPRICIKB-FNIJVURGSA-N |
| XLogP | 5.39 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|