C19H25N3O — CID 41082819
(3R)-3-imidazol-1-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]hexanamide (PubChem CID 41082819) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (3R)-3-imidazol-1-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]hexanamide.
| Compound Name | (3R)-3-imidazol-1-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]hexanamide |
|---|---|
| PubChem CID | 41082819 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (3R)-3-imidazol-1-yl-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]hexanamide |
| SMILES | CCC[C@H](CC(=O)N[C@H]1CCCc2ccccc21)n1ccnc1 |
| InChI | InChI=1S/C19H25N3O/c1-2-6-16(22-12-11-20-14-22)13-19(23)21-18-10-5-8-15-7-3-4-9-17(15)18/h3-4,7,9,11-12,14,16,18H,2,5-6,8,10,13H2,1H3,(H,21,23)/t16-,18+/m1/s1 |
| InChIKey | CNAKWJOKFULJSJ-AEFFLSMTSA-N |
| XLogP | 3.81 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |