C15H17N3O — CID 17491802
2-imidazol-1-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 17491802) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-imidazol-1-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-imidazol-1-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 17491802 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-imidazol-1-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | O=C(Cn1ccnc1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C15H17N3O/c19-15(10-18-9-8-16-11-18)17-14-7-3-5-12-4-1-2-6-13(12)14/h1-2,4,6,8-9,11,14H,3,5,7,10H2,(H,17,19) |
| InChIKey | HDOPVWFHNAJPSA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |