C25H24N2OS — CID 2338826
3-phenothiazin-10-yl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide (PubChem CID 2338826) has the molecular formula C25H24N2OS and a molecular weight of 400.55 g/mol. Its IUPAC name is 3-phenothiazin-10-yl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide.
| Compound Name | 3-phenothiazin-10-yl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
|---|---|
| PubChem CID | 2338826 |
| Molecular Formula | C25H24N2OS |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | 3-phenothiazin-10-yl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]propanamide |
| SMILES | O=C(CCN1c2ccccc2Sc2ccccc21)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C25H24N2OS/c28-25(26-20-11-7-9-18-8-1-2-10-19(18)20)16-17-27-21-12-3-5-14-23(21)29-24-15-6-4-13-22(24)27/h1-6,8,10,12-15,20H,7,9,11,16-17H2,(H,26,28)/t20-/m1/s1 |
| InChIKey | VDIKSQDWUDMHGQ-HXUWFJFHSA-N |
| XLogP | 5.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|