C18H18ClNO3S — CID 17484910
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3,4-dimethoxybenzamide (PubChem CID 17484910) has the molecular formula C18H18ClNO3S and a molecular weight of 363.87 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3,4-dimethoxybenzamide.
| Compound Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17484910 |
| Molecular Formula | C18H18ClNO3S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NC2CCSc3ccc(Cl)cc32)cc1OC |
| InChI | InChI=1S/C18H18ClNO3S/c1-22-15-5-3-11(9-16(15)23-2)18(21)20-14-7-8-24-17-6-4-12(19)10-13(14)17/h3-6,9-10,14H,7-8H2,1-2H3,(H,20,21) |
| InChIKey | SOIHAXQTQVMJSW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |