C15H13ClN2OS — CID 17479306
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyridine-4-carboxamide (PubChem CID 17479306) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyridine-4-carboxamide.
| Compound Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 17479306 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)pyridine-4-carboxamide |
| SMILES | O=C(NC1CCSc2ccc(Cl)cc21)c1ccncc1 |
| InChI | InChI=1S/C15H13ClN2OS/c16-11-1-2-14-12(9-11)13(5-8-20-14)18-15(19)10-3-6-17-7-4-10/h1-4,6-7,9,13H,5,8H2,(H,18,19) |
| InChIKey | GEIAJTVAKQOMFM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |