C20H24ClNOS — CID 18120449
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)adamantane-1-carboxamide (PubChem CID 18120449) has the molecular formula C20H24ClNOS and a molecular weight of 361.94 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)adamantane-1-carboxamide.
| Compound Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 18120449 |
| Molecular Formula | C20H24ClNOS |
| Molecular Weight | 361.94 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)adamantane-1-carboxamide |
| SMILES | O=C(NC1CCSc2ccc(Cl)cc21)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H24ClNOS/c21-15-1-2-18-16(8-15)17(3-4-24-18)22-19(23)20-9-12-5-13(10-20)7-14(6-12)11-20/h1-2,8,12-14,17H,3-7,9-11H2,(H,22,23) |
| InChIKey | KXSQVEQMVPTPHY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.94 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |