C14H17BrClNOS — CID 43699787
2-bromo-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylbutanamide (PubChem CID 43699787) has the molecular formula C14H17BrClNOS and a molecular weight of 362.72 g/mol. Its IUPAC name is 2-bromo-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylbutanamide.
| Compound Name | 2-bromo-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 43699787 |
| Molecular Formula | C14H17BrClNOS |
| Molecular Weight | 362.72 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-bromo-N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-3-methylbutanamide |
| SMILES | CC(C)C(Br)C(=O)NC1CCSc2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H17BrClNOS/c1-8(2)13(15)14(18)17-11-5-6-19-12-4-3-9(16)7-10(11)12/h3-4,7-8,11,13H,5-6H2,1-2H3,(H,17,18) |
| InChIKey | MFONXSZPTIHHSX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|