C20H17ClN2O3S — CID 43034323
N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 43034323) has the molecular formula C20H17ClN2O3S and a molecular weight of 400.89 g/mol. Its IUPAC name is N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 43034323 |
| Molecular Formula | C20H17ClN2O3S |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-(6-chloro-3,4-dihydro-2H-thiochromen-4-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)NC1CCSc2ccc(Cl)cc21)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H17ClN2O3S/c1-11(23-19(25)13-4-2-3-5-14(13)20(23)26)18(24)22-16-8-9-27-17-7-6-12(21)10-15(16)17/h2-7,10-11,16H,8-9H2,1H3,(H,22,24) |
| InChIKey | DCAKYLAKHBSUET-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|