C20H24ClNOS — CID 98318255
(5R,7R)-3-chloro-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]adamantane-1-carboxamide (PubChem CID 98318255) has the molecular formula C20H24ClNOS and a molecular weight of 361.94 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98318255 |
| Molecular Formula | C20H24ClNOS |
| Molecular Weight | 361.94 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | (5R,7R)-3-chloro-N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]adamantane-1-carboxamide |
| SMILES | O=C(N[C@@H]1CCSc2ccccc21)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C20H24ClNOS/c21-20-10-13-7-14(11-20)9-19(8-13,12-20)18(23)22-16-5-6-24-17-4-2-1-3-15(16)17/h1-4,13-14,16H,5-12H2,(H,22,23)/t13-,14-,16-,19?,20?/m1/s1 |
| InChIKey | XIDJFIODDDAPIF-ZTZSKLLQSA-N |
| XLogP | 4.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.94 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|