C23H27N3OS2 — CID 1141375
3-cyclohexyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 1141375) has the molecular formula C23H27N3OS2 and a molecular weight of 425.62 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-cyclohexyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1141375 |
| Molecular Formula | C23H27N3OS2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-cyclohexyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(Cc3cccs3)C(=S)NC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C23H27N3OS2/c1-16-9-10-21-17(12-16)13-18(22(27)25-21)14-26(15-20-8-5-11-29-20)23(28)24-19-6-3-2-4-7-19/h5,8-13,19H,2-4,6-7,14-15H2,1H3,(H,24,28)(H,25,27) |
| InChIKey | BIWQGVAYLNHWER-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|