C23H28N4S — CID 23736254
3-(1-adamantyl)-1,1-bis(pyridin-2-ylmethyl)thiourea (PubChem CID 23736254) has the molecular formula C23H28N4S and a molecular weight of 392.57 g/mol. Its IUPAC name is 3-(1-adamantyl)-1,1-bis(pyridin-2-ylmethyl)thiourea.
| Compound Name | 3-(1-adamantyl)-1,1-bis(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 23736254 |
| Molecular Formula | C23H28N4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-(1-adamantyl)-1,1-bis(pyridin-2-ylmethyl)thiourea |
| SMILES | S=C(NC12CC3CC(CC(C3)C1)C2)N(Cc1ccccn1)Cc1ccccn1 |
| InChI | InChI=1S/C23H28N4S/c28-22(26-23-12-17-9-18(13-23)11-19(10-17)14-23)27(15-20-5-1-3-7-24-20)16-21-6-2-4-8-25-21/h1-8,17-19H,9-16H2,(H,26,28) |
| InChIKey | QUPHTNAMFJIDCS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|