C23H26N4S — CID 23789776
3-(4-tert-butylphenyl)-1,1-bis(pyridin-2-ylmethyl)thiourea (PubChem CID 23789776) has the molecular formula C23H26N4S and a molecular weight of 390.56 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1,1-bis(pyridin-2-ylmethyl)thiourea.
| Compound Name | 3-(4-tert-butylphenyl)-1,1-bis(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 23789776 |
| Molecular Formula | C23H26N4S |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1,1-bis(pyridin-2-ylmethyl)thiourea |
| SMILES | CC(C)(C)c1ccc(NC(=S)N(Cc2ccccn2)Cc2ccccn2)cc1 |
| InChI | InChI=1S/C23H26N4S/c1-23(2,3)18-10-12-19(13-11-18)26-22(28)27(16-20-8-4-6-14-24-20)17-21-9-5-7-15-25-21/h4-15H,16-17H2,1-3H3,(H,26,28) |
| InChIKey | WAMYFLCVCCPFOI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|