C19H15ClF3N3OS — CID 22778374
3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 22778374) has the molecular formula C19H15ClF3N3OS and a molecular weight of 425.86 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 22778374 |
| Molecular Formula | C19H15ClF3N3OS |
| Molecular Weight | 425.86 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-1-(furan-2-ylmethyl)-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | FC(F)(F)c1ccc(Cl)c(NC(=S)N(Cc2ccccn2)Cc2ccco2)c1 |
| InChI | InChI=1S/C19H15ClF3N3OS/c20-16-7-6-13(19(21,22)23)10-17(16)25-18(28)26(12-15-5-3-9-27-15)11-14-4-1-2-8-24-14/h1-10H,11-12H2,(H,25,28) |
| InChIKey | ITRLMXCMVMRTJS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.86 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|