C18H13ClF3N3O2 — CID 109209570
N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(furan-2-ylmethylamino)pyridine-2-carboxamide (PubChem CID 109209570) has the molecular formula C18H13ClF3N3O2 and a molecular weight of 395.77 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(furan-2-ylmethylamino)pyridine-2-carboxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(furan-2-ylmethylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109209570 |
| Molecular Formula | C18H13ClF3N3O2 |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-4-(furan-2-ylmethylamino)pyridine-2-carboxamide |
| SMILES | O=C(Nc1cc(C(F)(F)F)ccc1Cl)c1cc(NCc2ccco2)ccn1 |
| InChI | InChI=1S/C18H13ClF3N3O2/c19-14-4-3-11(18(20,21)22)8-15(14)25-17(26)16-9-12(5-6-23-16)24-10-13-2-1-7-27-13/h1-9H,10H2,(H,23,24)(H,25,26) |
| InChIKey | TYRWVBADJZOQNN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |