C17H13F3N4O2 — CID 109346240
6-(furan-2-ylmethylamino)-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide (PubChem CID 109346240) has the molecular formula C17H13F3N4O2 and a molecular weight of 362.31 g/mol. Its IUPAC name is 6-(furan-2-ylmethylamino)-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(furan-2-ylmethylamino)-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109346240 |
| Molecular Formula | C17H13F3N4O2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 6-(furan-2-ylmethylamino)-N-[4-(trifluoromethyl)phenyl]pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)c1cc(NCc2ccco2)ncn1 |
| InChI | InChI=1S/C17H13F3N4O2/c18-17(19,20)11-3-5-12(6-4-11)24-16(25)14-8-15(23-10-22-14)21-9-13-2-1-7-26-13/h1-8,10H,9H2,(H,24,25)(H,21,22,23) |
| InChIKey | FVQXMYLYYPXFPI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |