C15H18N4O2 — CID 109341395
N-cyclopentyl-6-(furan-2-ylmethylamino)pyrimidine-4-carboxamide (PubChem CID 109341395) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-cyclopentyl-6-(furan-2-ylmethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-cyclopentyl-6-(furan-2-ylmethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109341395 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | N-cyclopentyl-6-(furan-2-ylmethylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(NC1CCCC1)c1cc(NCc2ccco2)ncn1 |
| InChI | InChI=1S/C15H18N4O2/c20-15(19-11-4-1-2-5-11)13-8-14(18-10-17-13)16-9-12-6-3-7-21-12/h3,6-8,10-11H,1-2,4-5,9H2,(H,19,20)(H,16,17,18) |
| InChIKey | AFJOIYDUTWNFPE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |