C25H35N3O3S — CID 4185597
1-[(2,4-dimethoxyphenyl)methyl]-3-(3,4-dimethylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 4185597) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-(3,4-dimethylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-(3,4-dimethylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 4185597 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-(3,4-dimethylphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | COc1ccc(CN(CCCN2CCOCC2)C(=S)Nc2ccc(C)c(C)c2)c(OC)c1 |
| InChI | InChI=1S/C25H35N3O3S/c1-19-6-8-22(16-20(19)2)26-25(32)28(11-5-10-27-12-14-31-15-13-27)18-21-7-9-23(29-3)17-24(21)30-4/h6-9,16-17H,5,10-15,18H2,1-4H3,(H,26,32) |
| InChIKey | DAXJXMDCZVBXHM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|