C14H9Cl2N3O3S — CID 4981026
N-[(2,3-dichlorophenyl)carbamothioyl]-4-nitrobenzamide (PubChem CID 4981026) has the molecular formula C14H9Cl2N3O3S and a molecular weight of 370.22 g/mol. Its IUPAC name is N-[(2,3-dichlorophenyl)carbamothioyl]-4-nitrobenzamide.
| Compound Name | N-[(2,3-dichlorophenyl)carbamothioyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4981026 |
| Molecular Formula | C14H9Cl2N3O3S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | N-[(2,3-dichlorophenyl)carbamothioyl]-4-nitrobenzamide |
| SMILES | O=C(NC(=S)Nc1cccc(Cl)c1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H9Cl2N3O3S/c15-10-2-1-3-11(12(10)16)17-14(23)18-13(20)8-4-6-9(7-5-8)19(21)22/h1-7H,(H2,17,18,20,23) |
| InChIKey | QPTFHWFQZBOXKD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|