C8H6Cl3N3O3S — CID 59715453
2-[(2,2,2-trichloroacetyl)carbamoylamino]thiophene-3-carboxamide (PubChem CID 59715453) has the molecular formula C8H6Cl3N3O3S and a molecular weight of 330.58 g/mol. Its IUPAC name is 2-[(2,2,2-trichloroacetyl)carbamoylamino]thiophene-3-carboxamide.
| Compound Name | 2-[(2,2,2-trichloroacetyl)carbamoylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 59715453 |
| Molecular Formula | C8H6Cl3N3O3S |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | 2-[(2,2,2-trichloroacetyl)carbamoylamino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H6Cl3N3O3S/c9-8(10,11)6(16)14-7(17)13-5-3(4(12)15)1-2-18-5/h1-2H,(H2,12,15)(H2,13,14,16,17) |
| InChIKey | SNSPWOTXTJLFSP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|